C11H15N7O2S — CID 80901595
N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-6-hydrazinyl-5-nitropyrimidin-4-amine (PubChem CID 80901595) has the molecular formula C11H15N7O2S and a molecular weight of 309.36 g/mol. Its IUPAC name is N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-6-hydrazinyl-5-nitropyrimidin-4-amine.
| Compound Name | N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-6-hydrazinyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 80901595 |
| Molecular Formula | C11H15N7O2S |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-6-hydrazinyl-5-nitropyrimidin-4-amine |
| SMILES | Cc1nc(C)c(C(C)Nc2ncnc(NN)c2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C11H15N7O2S/c1-5-9(21-7(3)15-5)6(2)16-10-8(18(19)20)11(17-12)14-4-13-10/h4,6H,12H2,1-3H3,(H2,13,14,16,17) |
| InChIKey | GTXFBYGMNDNIGG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|