C8H13N5O3S — CID 80927305
3-(6-hydrazinyl-5-nitropyrimidin-4-yl)sulfanylbutan-1-ol (PubChem CID 80927305) has the molecular formula C8H13N5O3S and a molecular weight of 259.29 g/mol. Its IUPAC name is 3-(6-hydrazinyl-5-nitropyrimidin-4-yl)sulfanylbutan-1-ol.
| Compound Name | 3-(6-hydrazinyl-5-nitropyrimidin-4-yl)sulfanylbutan-1-ol |
|---|---|
| PubChem CID | 80927305 |
| Molecular Formula | C8H13N5O3S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 3-(6-hydrazinyl-5-nitropyrimidin-4-yl)sulfanylbutan-1-ol |
| SMILES | CC(CCO)Sc1ncnc(NN)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H13N5O3S/c1-5(2-3-14)17-8-6(13(15)16)7(12-9)10-4-11-8/h4-5,14H,2-3,9H2,1H3,(H,10,11,12) |
| InChIKey | UWPCAZRETZPWJW-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|