C6H9N5O4 — CID 80912433
2-(6-hydrazinyl-5-nitropyrimidin-4-yl)oxyethanol (PubChem CID 80912433) has the molecular formula C6H9N5O4 and a molecular weight of 215.17 g/mol. Its IUPAC name is 2-(6-hydrazinyl-5-nitropyrimidin-4-yl)oxyethanol.
| Compound Name | 2-(6-hydrazinyl-5-nitropyrimidin-4-yl)oxyethanol |
|---|---|
| PubChem CID | 80912433 |
| Molecular Formula | C6H9N5O4 |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 2-(6-hydrazinyl-5-nitropyrimidin-4-yl)oxyethanol |
| SMILES | NNc1ncnc(OCCO)c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H9N5O4/c7-10-5-4(11(13)14)6(9-3-8-5)15-2-1-12/h3,12H,1-2,7H2,(H,8,9,10) |
| InChIKey | LIDIJPRGTOEBBR-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|