C7H8F3N5O3 — CID 82957059
[5-nitro-6-(3,3,3-trifluoropropoxy)pyrimidin-4-yl]hydrazine (PubChem CID 82957059) has the molecular formula C7H8F3N5O3 and a molecular weight of 267.17 g/mol. Its IUPAC name is [5-nitro-6-(3,3,3-trifluoropropoxy)pyrimidin-4-yl]hydrazine.
| Compound Name | [5-nitro-6-(3,3,3-trifluoropropoxy)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 82957059 |
| Molecular Formula | C7H8F3N5O3 |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | [5-nitro-6-(3,3,3-trifluoropropoxy)pyrimidin-4-yl]hydrazine |
| SMILES | NNc1ncnc(OCCC(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H8F3N5O3/c8-7(9,10)1-2-18-6-4(15(16)17)5(14-11)12-3-13-6/h3H,1-2,11H2,(H,12,13,14) |
| InChIKey | VLXPHVJDDOVQIB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|