C11H13ClN4O6 — CID 121352108
dimethyl 2-[(2-chloro-5-nitropyrimidin-4-yl)amino]pentanedioate (PubChem CID 121352108) has the molecular formula C11H13ClN4O6 and a molecular weight of 332.70 g/mol. Its IUPAC name is dimethyl 2-[(2-chloro-5-nitropyrimidin-4-yl)amino]pentanedioate.
| Compound Name | dimethyl 2-[(2-chloro-5-nitropyrimidin-4-yl)amino]pentanedioate |
|---|---|
| PubChem CID | 121352108 |
| Molecular Formula | C11H13ClN4O6 |
| Molecular Weight | 332.70 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | dimethyl 2-[(2-chloro-5-nitropyrimidin-4-yl)amino]pentanedioate |
| SMILES | COC(=O)CCC(Nc1nc(Cl)ncc1[N+](=O)[O-])C(=O)OC |
| InChI | InChI=1S/C11H13ClN4O6/c1-21-8(17)4-3-6(10(18)22-2)14-9-7(16(19)20)5-13-11(12)15-9/h5-6H,3-4H2,1-2H3,(H,13,14,15) |
| InChIKey | WPBXOVWJADQNQT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.70 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|