C16H21ClN4O9 — CID 169193384
dimethyl (4S)-2-(2-chloro-5-nitropyrimidin-4-yl)oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (PubChem CID 169193384) has the molecular formula C16H21ClN4O9 and a molecular weight of 448.82 g/mol. Its IUPAC name is dimethyl (4S)-2-(2-chloro-5-nitropyrimidin-4-yl)oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate.
| Compound Name | dimethyl (4S)-2-(2-chloro-5-nitropyrimidin-4-yl)oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
|---|---|
| PubChem CID | 169193384 |
| Molecular Formula | C16H21ClN4O9 |
| Molecular Weight | 448.82 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | dimethyl (4S)-2-(2-chloro-5-nitropyrimidin-4-yl)oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| SMILES | COC(=O)C(C[C@H](NC(=O)OC(C)(C)C)C(=O)OC)Oc1nc(Cl)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H21ClN4O9/c1-16(2,3)30-15(24)19-8(12(22)27-4)6-10(13(23)28-5)29-11-9(21(25)26)7-18-14(17)20-11/h7-8,10H,6H2,1-5H3,(H,19,24)/t8-,10?/m0/s1 |
| InChIKey | TYQMZCBXGDRNND-PEHGTWAWSA-N |
| XLogP | 1.41 |
| TPSA | 169.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.82 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|