C15H27NO7 — CID 58331111
dimethyl (4S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-propoxypentanedioate (PubChem CID 58331111) has the molecular formula C15H27NO7 and a molecular weight of 333.38 g/mol. Its IUPAC name is dimethyl (4S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-propoxypentanedioate.
| Compound Name | dimethyl (4S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-propoxypentanedioate |
|---|---|
| PubChem CID | 58331111 |
| Molecular Formula | C15H27NO7 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | dimethyl (4S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-propoxypentanedioate |
| SMILES | CCCO[C@@H](CC(NC(=O)OC(C)(C)C)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C15H27NO7/c1-7-8-22-11(13(18)21-6)9-10(12(17)20-5)16-14(19)23-15(2,3)4/h10-11H,7-9H2,1-6H3,(H,16,19)/t10?,11-/m0/s1 |
| InChIKey | NEMBMURCJLRMTH-DTIOYNMSSA-N |
| XLogP | 1.41 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|