C13H25NO5 — CID 134525885
methyl 3-butoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 134525885) has the molecular formula C13H25NO5 and a molecular weight of 275.34 g/mol. Its IUPAC name is methyl 3-butoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl 3-butoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 134525885 |
| Molecular Formula | C13H25NO5 |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | methyl 3-butoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CCCCOCC(NC(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C13H25NO5/c1-6-7-8-18-9-10(11(15)17-5)14-12(16)19-13(2,3)4/h10H,6-9H2,1-5H3,(H,14,16) |
| InChIKey | IQOKPWOEDPIFHC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|