C12H25N3O4 — CID 88895904
tert-butyl N-[(1Z)-1-amino-3-butoxy-1-hydroxyiminopropan-2-yl]carbamate (PubChem CID 88895904) has the molecular formula C12H25N3O4 and a molecular weight of 275.35 g/mol. Its IUPAC name is tert-butyl N-[(1Z)-1-amino-3-butoxy-1-hydroxyiminopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(1Z)-1-amino-3-butoxy-1-hydroxyiminopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 88895904 |
| Molecular Formula | C12H25N3O4 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | tert-butyl N-[(1Z)-1-amino-3-butoxy-1-hydroxyiminopropan-2-yl]carbamate |
| SMILES | CCCCOCC(NC(=O)OC(C)(C)C)/C(N)=N/O |
| InChI | InChI=1S/C12H25N3O4/c1-5-6-7-18-8-9(10(13)15-17)14-11(16)19-12(2,3)4/h9,17H,5-8H2,1-4H3,(H2,13,15)(H,14,16) |
| InChIKey | UEWGBXHPHQTDAQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|