C14H25NO6 — CID 118190807
4-O-butyl 1-O-methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (PubChem CID 118190807) has the molecular formula C14H25NO6 and a molecular weight of 303.36 g/mol. Its IUPAC name is 4-O-butyl 1-O-methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate.
| Compound Name | 4-O-butyl 1-O-methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
|---|---|
| PubChem CID | 118190807 |
| Molecular Formula | C14H25NO6 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 4-O-butyl 1-O-methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| SMILES | CCCCOC(=O)CC(NC(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C14H25NO6/c1-6-7-8-20-11(16)9-10(12(17)19-5)15-13(18)21-14(2,3)4/h10H,6-9H2,1-5H3,(H,15,18) |
| InChIKey | BQOJZQSJHADOMU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|