C18H35N3O5S — CID 71739960
tert-butyl 5-[(4Z)-4-amino-4-hydroxyimino-3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]sulfanylpentanoate (PubChem CID 71739960) has the molecular formula C18H35N3O5S and a molecular weight of 405.56 g/mol. Its IUPAC name is tert-butyl 5-[(4Z)-4-amino-4-hydroxyimino-3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]sulfanylpentanoate.
| Compound Name | tert-butyl 5-[(4Z)-4-amino-4-hydroxyimino-3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]sulfanylpentanoate |
|---|---|
| PubChem CID | 71739960 |
| Molecular Formula | C18H35N3O5S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | tert-butyl 5-[(4Z)-4-amino-4-hydroxyimino-3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]sulfanylpentanoate |
| SMILES | CC(C)(C)OC(=O)CCCCSCCC(NC(=O)OC(C)(C)C)/C(N)=N/O |
| InChI | InChI=1S/C18H35N3O5S/c1-17(2,3)25-14(22)9-7-8-11-27-12-10-13(15(19)21-24)20-16(23)26-18(4,5)6/h13,24H,7-12H2,1-6H3,(H2,19,21)(H,20,23) |
| InChIKey | LMHYNMVRULGFEM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|