C14H23NO8S — CID 176910786
2-[[(3S)-3-carboxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]sulfanylmethyl]butanedioic acid (PubChem CID 176910786) has the molecular formula C14H23NO8S and a molecular weight of 365.40 g/mol. Its IUPAC name is 2-[[(3S)-3-carboxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]sulfanylmethyl]butanedioic acid.
| Compound Name | 2-[[(3S)-3-carboxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]sulfanylmethyl]butanedioic acid |
|---|---|
| PubChem CID | 176910786 |
| Molecular Formula | C14H23NO8S |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 2-[[(3S)-3-carboxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]sulfanylmethyl]butanedioic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCSCC(CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H23NO8S/c1-14(2,3)23-13(22)15-9(12(20)21)4-5-24-7-8(11(18)19)6-10(16)17/h8-9H,4-7H2,1-3H3,(H,15,22)(H,16,17)(H,18,19)(H,20,21)/t8?,9-/m0/s1 |
| InChIKey | RHJBDPZRGQGTJB-GKAPJAKFSA-N |
| XLogP | 1.26 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|