C10H17NO6S2 — CID 13367329
(2R)-3-(methoxycarbonyldisulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 13367329) has the molecular formula C10H17NO6S2 and a molecular weight of 311.38 g/mol. Its IUPAC name is (2R)-3-(methoxycarbonyldisulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2R)-3-(methoxycarbonyldisulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 13367329 |
| Molecular Formula | C10H17NO6S2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | (2R)-3-(methoxycarbonyldisulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | COC(=O)SSC[C@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C10H17NO6S2/c1-10(2,3)17-8(14)11-6(7(12)13)5-18-19-9(15)16-4/h6H,5H2,1-4H3,(H,11,14)(H,12,13)/t6-/m0/s1 |
| InChIKey | BIJLJADFPYFTJY-LURJTMIESA-N |
| XLogP | 2.11 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|