C13H20N4O6 — CID 66898323
methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2-nitroimidazol-1-yl)butanoate (PubChem CID 66898323) has the molecular formula C13H20N4O6 and a molecular weight of 328.33 g/mol. Its IUPAC name is methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2-nitroimidazol-1-yl)butanoate.
| Compound Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2-nitroimidazol-1-yl)butanoate |
|---|---|
| PubChem CID | 66898323 |
| Molecular Formula | C13H20N4O6 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2-nitroimidazol-1-yl)butanoate |
| SMILES | COC(=O)C(CCn1ccnc1[N+](=O)[O-])NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H20N4O6/c1-13(2,3)23-12(19)15-9(10(18)22-4)5-7-16-8-6-14-11(16)17(20)21/h6,8-9H,5,7H2,1-4H3,(H,15,19) |
| InChIKey | PRDKTIIHNQNJCO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|