C16H20N4O4 — CID 70251008
tert-butyl N-[2-methyl-3-[(2-nitroimidazol-1-yl)methyl]phenyl]carbamate (PubChem CID 70251008) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is tert-butyl N-[2-methyl-3-[(2-nitroimidazol-1-yl)methyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-methyl-3-[(2-nitroimidazol-1-yl)methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 70251008 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | tert-butyl N-[2-methyl-3-[(2-nitroimidazol-1-yl)methyl]phenyl]carbamate |
| SMILES | Cc1c(Cn2ccnc2[N+](=O)[O-])cccc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H20N4O4/c1-11-12(10-19-9-8-17-14(19)20(22)23)6-5-7-13(11)18-15(21)24-16(2,3)4/h5-9H,10H2,1-4H3,(H,18,21) |
| InChIKey | CZGTWADCBLLMKM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|