C15H23NO5S — CID 139896423
2-[2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]ethyl methanesulfonate (PubChem CID 139896423) has the molecular formula C15H23NO5S and a molecular weight of 329.42 g/mol. Its IUPAC name is 2-[2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]ethyl methanesulfonate.
| Compound Name | 2-[2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 139896423 |
| Molecular Formula | C15H23NO5S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-[2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]ethyl methanesulfonate |
| SMILES | Cc1c(CCOS(C)(=O)=O)cccc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23NO5S/c1-11-12(9-10-20-22(5,18)19)7-6-8-13(11)16-14(17)21-15(2,3)4/h6-8H,9-10H2,1-5H3,(H,16,17) |
| InChIKey | HPFLYWQZWQOLPI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|