C14H20ClN5O6 — CID 87223383
tert-butyl N-[(2-chloro-5-nitropyrimidin-4-yl)-(1-methoxy-4-oxobutan-2-yl)amino]carbamate (PubChem CID 87223383) has the molecular formula C14H20ClN5O6 and a molecular weight of 389.80 g/mol. Its IUPAC name is tert-butyl N-[(2-chloro-5-nitropyrimidin-4-yl)-(1-methoxy-4-oxobutan-2-yl)amino]carbamate.
| Compound Name | tert-butyl N-[(2-chloro-5-nitropyrimidin-4-yl)-(1-methoxy-4-oxobutan-2-yl)amino]carbamate |
|---|---|
| PubChem CID | 87223383 |
| Molecular Formula | C14H20ClN5O6 |
| Molecular Weight | 389.80 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | tert-butyl N-[(2-chloro-5-nitropyrimidin-4-yl)-(1-methoxy-4-oxobutan-2-yl)amino]carbamate |
| SMILES | COCC(CC=O)N(NC(=O)OC(C)(C)C)c1nc(Cl)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H20ClN5O6/c1-14(2,3)26-13(22)18-19(9(5-6-21)8-25-4)11-10(20(23)24)7-16-12(15)17-11/h6-7,9H,5,8H2,1-4H3,(H,18,22) |
| InChIKey | URRAPDPOOSTSLV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 136.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.80 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|