C12H16ClN3O5 — CID 118996751
tert-butyl N-(4-chloro-3-ethoxy-5-nitro-2-pyridinyl)carbamate (PubChem CID 118996751) has the molecular formula C12H16ClN3O5 and a molecular weight of 317.73 g/mol. Its IUPAC name is tert-butyl N-(4-chloro-3-ethoxy-5-nitro-2-pyridinyl)carbamate.
| Compound Name | tert-butyl N-(4-chloro-3-ethoxy-5-nitro-2-pyridinyl)carbamate |
|---|---|
| PubChem CID | 118996751 |
| Molecular Formula | C12H16ClN3O5 |
| Molecular Weight | 317.73 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | tert-butyl N-(4-chloro-3-ethoxy-5-nitro-2-pyridinyl)carbamate |
| SMILES | CCOc1c(NC(=O)OC(C)(C)C)ncc([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C12H16ClN3O5/c1-5-20-9-8(13)7(16(18)19)6-14-10(9)15-11(17)21-12(2,3)4/h6H,5H2,1-4H3,(H,14,15,17) |
| InChIKey | MJFSELMRQKUNLP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.73 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|