C17H22N6O6 — CID 161489712
tert-butyl N-(3-methyl-5-nitro-2-pyridinyl)carbamate;3-methyl-5-nitropyridin-2-amine (PubChem CID 161489712) has the molecular formula C17H22N6O6 and a molecular weight of 406.40 g/mol. Its IUPAC name is tert-butyl N-(3-methyl-5-nitro-2-pyridinyl)carbamate;3-methyl-5-nitropyridin-2-amine.
| Compound Name | tert-butyl N-(3-methyl-5-nitro-2-pyridinyl)carbamate;3-methyl-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 161489712 |
| Molecular Formula | C17H22N6O6 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | tert-butyl N-(3-methyl-5-nitro-2-pyridinyl)carbamate;3-methyl-5-nitropyridin-2-amine |
| SMILES | Cc1cc([N+](=O)[O-])cnc1N.Cc1cc([N+](=O)[O-])cnc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H15N3O4.C6H7N3O2/c1-7-5-8(14(16)17)6-12-9(7)13-10(15)18-11(2,3)4;1-4-2-5(9(10)11)3-8-6(4)7/h5-6H,1-4H3,(H,12,13,15);2-3H,1H3,(H2,7,8) |
| InChIKey | WFLGGBNSYOUGII-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 176.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|