C9H12F2N4O2 — CID 114384478
2,2-difluoro-N'-(3-methyl-5-nitro-2-pyridinyl)propane-1,3-diamine (PubChem CID 114384478) has the molecular formula C9H12F2N4O2 and a molecular weight of 246.22 g/mol. Its IUPAC name is 2,2-difluoro-N'-(3-methyl-5-nitro-2-pyridinyl)propane-1,3-diamine.
| Compound Name | 2,2-difluoro-N'-(3-methyl-5-nitro-2-pyridinyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 114384478 |
| Molecular Formula | C9H12F2N4O2 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2,2-difluoro-N'-(3-methyl-5-nitro-2-pyridinyl)propane-1,3-diamine |
| SMILES | Cc1cc([N+](=O)[O-])cnc1NCC(F)(F)CN |
| InChI | InChI=1S/C9H12F2N4O2/c1-6-2-7(15(16)17)3-13-8(6)14-5-9(10,11)4-12/h2-3H,4-5,12H2,1H3,(H,13,14) |
| InChIKey | BNLIAPGXGDCFEJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|