C8H8ClF2N3O3 — CID 113462858
3-[(3-chloro-5-nitro-2-pyridinyl)amino]-2,2-difluoropropan-1-ol (PubChem CID 113462858) has the molecular formula C8H8ClF2N3O3 and a molecular weight of 267.62 g/mol. Its IUPAC name is 3-[(3-chloro-5-nitro-2-pyridinyl)amino]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[(3-chloro-5-nitro-2-pyridinyl)amino]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 113462858 |
| Molecular Formula | C8H8ClF2N3O3 |
| Molecular Weight | 267.62 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | 3-[(3-chloro-5-nitro-2-pyridinyl)amino]-2,2-difluoropropan-1-ol |
| SMILES | O=[N+]([O-])c1cnc(NCC(F)(F)CO)c(Cl)c1 |
| InChI | InChI=1S/C8H8ClF2N3O3/c9-6-1-5(14(16)17)2-12-7(6)13-3-8(10,11)4-15/h1-2,15H,3-4H2,(H,12,13) |
| InChIKey | GKSNPQMXHGIJIZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.62 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|