C9H10BrF2N3O3 — CID 104858447
3-[(3-bromo-4-methyl-5-nitro-2-pyridinyl)amino]-2,2-difluoropropan-1-ol (PubChem CID 104858447) has the molecular formula C9H10BrF2N3O3 and a molecular weight of 326.10 g/mol. Its IUPAC name is 3-[(3-bromo-4-methyl-5-nitro-2-pyridinyl)amino]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[(3-bromo-4-methyl-5-nitro-2-pyridinyl)amino]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 104858447 |
| Molecular Formula | C9H10BrF2N3O3 |
| Molecular Weight | 326.10 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 3-[(3-bromo-4-methyl-5-nitro-2-pyridinyl)amino]-2,2-difluoropropan-1-ol |
| SMILES | Cc1c([N+](=O)[O-])cnc(NCC(F)(F)CO)c1Br |
| InChI | InChI=1S/C9H10BrF2N3O3/c1-5-6(15(17)18)2-13-8(7(5)10)14-3-9(11,12)4-16/h2,16H,3-4H2,1H3,(H,13,14) |
| InChIKey | CEZLHCANROXJOR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.10 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|