C8H8BrF2N3O2 — CID 104508108
3-bromo-N-(2,2-difluoroethyl)-4-methyl-5-nitropyridin-2-amine (PubChem CID 104508108) has the molecular formula C8H8BrF2N3O2 and a molecular weight of 296.07 g/mol. Its IUPAC name is 3-bromo-N-(2,2-difluoroethyl)-4-methyl-5-nitropyridin-2-amine.
| Compound Name | 3-bromo-N-(2,2-difluoroethyl)-4-methyl-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 104508108 |
| Molecular Formula | C8H8BrF2N3O2 |
| Molecular Weight | 296.07 g/mol |
| Exact Mass | 294.98 |
| IUPAC Name | 3-bromo-N-(2,2-difluoroethyl)-4-methyl-5-nitropyridin-2-amine |
| SMILES | Cc1c([N+](=O)[O-])cnc(NCC(F)F)c1Br |
| InChI | InChI=1S/C8H8BrF2N3O2/c1-4-5(14(15)16)2-12-8(7(4)9)13-3-6(10)11/h2,6H,3H2,1H3,(H,12,13) |
| InChIKey | QIVKURUOFRJRMO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.07 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|