C10H10BrN3O2 — CID 104508007
3-bromo-N-but-3-ynyl-4-methyl-5-nitropyridin-2-amine (PubChem CID 104508007) has the molecular formula C10H10BrN3O2 and a molecular weight of 284.11 g/mol. Its IUPAC name is 3-bromo-N-but-3-ynyl-4-methyl-5-nitropyridin-2-amine.
| Compound Name | 3-bromo-N-but-3-ynyl-4-methyl-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 104508007 |
| Molecular Formula | C10H10BrN3O2 |
| Molecular Weight | 284.11 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 3-bromo-N-but-3-ynyl-4-methyl-5-nitropyridin-2-amine |
| SMILES | C#CCCNc1ncc([N+](=O)[O-])c(C)c1Br |
| InChI | InChI=1S/C10H10BrN3O2/c1-3-4-5-12-10-9(11)7(2)8(6-13-10)14(15)16/h1,6H,4-5H2,2H3,(H,12,13) |
| InChIKey | CAYRFOHLZIOEGX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.11 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|