C12H17BrN4O2 — CID 104508181
N'-(3-bromo-4-methyl-5-nitro-2-pyridinyl)-N-cyclopropylpropane-1,3-diamine (PubChem CID 104508181) has the molecular formula C12H17BrN4O2 and a molecular weight of 329.20 g/mol. Its IUPAC name is N'-(3-bromo-4-methyl-5-nitro-2-pyridinyl)-N-cyclopropylpropane-1,3-diamine.
| Compound Name | N'-(3-bromo-4-methyl-5-nitro-2-pyridinyl)-N-cyclopropylpropane-1,3-diamine |
|---|---|
| PubChem CID | 104508181 |
| Molecular Formula | C12H17BrN4O2 |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | N'-(3-bromo-4-methyl-5-nitro-2-pyridinyl)-N-cyclopropylpropane-1,3-diamine |
| SMILES | Cc1c([N+](=O)[O-])cnc(NCCCNC2CC2)c1Br |
| InChI | InChI=1S/C12H17BrN4O2/c1-8-10(17(18)19)7-16-12(11(8)13)15-6-2-5-14-9-3-4-9/h7,9,14H,2-6H2,1H3,(H,15,16) |
| InChIKey | LOFAJSJITQYUCB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|