C10H15BrN4O4S — CID 104576353
N-[3-[(3-bromo-4-methyl-5-nitro-2-pyridinyl)amino]propyl]methanesulfonamide (PubChem CID 104576353) has the molecular formula C10H15BrN4O4S and a molecular weight of 367.23 g/mol. Its IUPAC name is N-[3-[(3-bromo-4-methyl-5-nitro-2-pyridinyl)amino]propyl]methanesulfonamide.
| Compound Name | N-[3-[(3-bromo-4-methyl-5-nitro-2-pyridinyl)amino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 104576353 |
| Molecular Formula | C10H15BrN4O4S |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | N-[3-[(3-bromo-4-methyl-5-nitro-2-pyridinyl)amino]propyl]methanesulfonamide |
| SMILES | Cc1c([N+](=O)[O-])cnc(NCCCNS(C)(=O)=O)c1Br |
| InChI | InChI=1S/C10H15BrN4O4S/c1-7-8(15(16)17)6-13-10(9(7)11)12-4-3-5-14-20(2,18)19/h6,14H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | QFRFEBDEFNKHOA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|