C13H18BrN3O4 — CID 104507474
3-[(3-bromo-4-methyl-5-nitro-2-pyridinyl)amino]-2,2,3-trimethylbutanoic acid (PubChem CID 104507474) has the molecular formula C13H18BrN3O4 and a molecular weight of 360.21 g/mol. Its IUPAC name is 3-[(3-bromo-4-methyl-5-nitro-2-pyridinyl)amino]-2,2,3-trimethylbutanoic acid.
| Compound Name | 3-[(3-bromo-4-methyl-5-nitro-2-pyridinyl)amino]-2,2,3-trimethylbutanoic acid |
|---|---|
| PubChem CID | 104507474 |
| Molecular Formula | C13H18BrN3O4 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 3-[(3-bromo-4-methyl-5-nitro-2-pyridinyl)amino]-2,2,3-trimethylbutanoic acid |
| SMILES | Cc1c([N+](=O)[O-])cnc(NC(C)(C)C(C)(C)C(=O)O)c1Br |
| InChI | InChI=1S/C13H18BrN3O4/c1-7-8(17(20)21)6-15-10(9(7)14)16-13(4,5)12(2,3)11(18)19/h6H,1-5H3,(H,15,16)(H,18,19) |
| InChIKey | MACHNVARUAATSF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|