C12H18BrN3O4 — CID 104576400
1-[(3-bromo-4-methyl-5-nitro-2-pyridinyl)amino]-4-methoxy-2-methylbutan-2-ol (PubChem CID 104576400) has the molecular formula C12H18BrN3O4 and a molecular weight of 348.20 g/mol. Its IUPAC name is 1-[(3-bromo-4-methyl-5-nitro-2-pyridinyl)amino]-4-methoxy-2-methylbutan-2-ol.
| Compound Name | 1-[(3-bromo-4-methyl-5-nitro-2-pyridinyl)amino]-4-methoxy-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 104576400 |
| Molecular Formula | C12H18BrN3O4 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 1-[(3-bromo-4-methyl-5-nitro-2-pyridinyl)amino]-4-methoxy-2-methylbutan-2-ol |
| SMILES | COCCC(C)(O)CNc1ncc([N+](=O)[O-])c(C)c1Br |
| InChI | InChI=1S/C12H18BrN3O4/c1-8-9(16(18)19)6-14-11(10(8)13)15-7-12(2,17)4-5-20-3/h6,17H,4-5,7H2,1-3H3,(H,14,15) |
| InChIKey | JOLGYSORBKEBDL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|