C9H9F2N3O5 — CID 114154314
2-[(2,2-difluoro-3-hydroxypropyl)amino]-5-nitropyridine-3-carboxylic acid (PubChem CID 114154314) has the molecular formula C9H9F2N3O5 and a molecular weight of 277.18 g/mol. Its IUPAC name is 2-[(2,2-difluoro-3-hydroxypropyl)amino]-5-nitropyridine-3-carboxylic acid.
| Compound Name | 2-[(2,2-difluoro-3-hydroxypropyl)amino]-5-nitropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 114154314 |
| Molecular Formula | C9H9F2N3O5 |
| Molecular Weight | 277.18 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 2-[(2,2-difluoro-3-hydroxypropyl)amino]-5-nitropyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cnc1NCC(F)(F)CO |
| InChI | InChI=1S/C9H9F2N3O5/c10-9(11,4-15)3-13-7-6(8(16)17)1-5(2-12-7)14(18)19/h1-2,15H,3-4H2,(H,12,13)(H,16,17) |
| InChIKey | OEQFXUUREYXBOE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.18 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|