C17H22N6O6 — CID 161033777
tert-butyl N-(3,5-diaminophenyl)carbamate;3,5-dinitroaniline (PubChem CID 161033777) has the molecular formula C17H22N6O6 and a molecular weight of 406.40 g/mol. Its IUPAC name is tert-butyl N-(3,5-diaminophenyl)carbamate;3,5-dinitroaniline.
| Compound Name | tert-butyl N-(3,5-diaminophenyl)carbamate;3,5-dinitroaniline |
|---|---|
| PubChem CID | 161033777 |
| Molecular Formula | C17H22N6O6 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | tert-butyl N-(3,5-diaminophenyl)carbamate;3,5-dinitroaniline |
| SMILES | CC(C)(C)OC(=O)Nc1cc(N)cc(N)c1.Nc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H17N3O2.C6H5N3O4/c1-11(2,3)16-10(15)14-9-5-7(12)4-8(13)6-9;7-4-1-5(8(10)11)3-6(2-4)9(12)13/h4-6H,12-13H2,1-3H3,(H,14,15);1-3H,7H2 |
| InChIKey | TZZBZMXYRMLNHA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 202.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|