C11H14I2N2O2 — CID 15273422
tert-butyl N-(4-amino-3,5-diiodophenyl)carbamate (PubChem CID 15273422) has the molecular formula C11H14I2N2O2 and a molecular weight of 460.05 g/mol. Its IUPAC name is tert-butyl N-(4-amino-3,5-diiodophenyl)carbamate.
| Compound Name | tert-butyl N-(4-amino-3,5-diiodophenyl)carbamate |
|---|---|
| PubChem CID | 15273422 |
| Molecular Formula | C11H14I2N2O2 |
| Molecular Weight | 460.05 g/mol |
| Exact Mass | 459.91 |
| IUPAC Name | tert-butyl N-(4-amino-3,5-diiodophenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(I)c(N)c(I)c1 |
| InChI | InChI=1S/C11H14I2N2O2/c1-11(2,3)17-10(16)15-6-4-7(12)9(14)8(13)5-6/h4-5H,14H2,1-3H3,(H,15,16) |
| InChIKey | DEELTJVFMZZPKO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.05 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|