C13H17N3O2 — CID 82013863
tert-butyl N-(4-amino-3-cyano-5-methylphenyl)carbamate (PubChem CID 82013863) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is tert-butyl N-(4-amino-3-cyano-5-methylphenyl)carbamate.
| Compound Name | tert-butyl N-(4-amino-3-cyano-5-methylphenyl)carbamate |
|---|---|
| PubChem CID | 82013863 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | tert-butyl N-(4-amino-3-cyano-5-methylphenyl)carbamate |
| SMILES | Cc1cc(NC(=O)OC(C)(C)C)cc(C#N)c1N |
| InChI | InChI=1S/C13H17N3O2/c1-8-5-10(6-9(7-14)11(8)15)16-12(17)18-13(2,3)4/h5-6H,15H2,1-4H3,(H,16,17) |
| InChIKey | SIPUPBXUIRGPNT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|