C15H16N2O2 — CID 167737859
tert-butyl N-(4-cyano-2-ethynyl-6-methylphenyl)carbamate (PubChem CID 167737859) has the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. Its IUPAC name is tert-butyl N-(4-cyano-2-ethynyl-6-methylphenyl)carbamate.
| Compound Name | tert-butyl N-(4-cyano-2-ethynyl-6-methylphenyl)carbamate |
|---|---|
| PubChem CID | 167737859 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | tert-butyl N-(4-cyano-2-ethynyl-6-methylphenyl)carbamate |
| SMILES | C#Cc1cc(C#N)cc(C)c1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H16N2O2/c1-6-12-8-11(9-16)7-10(2)13(12)17-14(18)19-15(3,4)5/h1,7-8H,2-5H3,(H,17,18) |
| InChIKey | SWRXTNALMDDDFF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|