C16H22FN3O2 — CID 103821802
tert-butyl N-[3-(5-cyano-3-fluoro-2-methylanilino)propyl]carbamate (PubChem CID 103821802) has the molecular formula C16H22FN3O2 and a molecular weight of 307.37 g/mol. Its IUPAC name is tert-butyl N-[3-(5-cyano-3-fluoro-2-methylanilino)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(5-cyano-3-fluoro-2-methylanilino)propyl]carbamate |
|---|---|
| PubChem CID | 103821802 |
| Molecular Formula | C16H22FN3O2 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | tert-butyl N-[3-(5-cyano-3-fluoro-2-methylanilino)propyl]carbamate |
| SMILES | Cc1c(F)cc(C#N)cc1NCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H22FN3O2/c1-11-13(17)8-12(10-18)9-14(11)19-6-5-7-20-15(21)22-16(2,3)4/h8-9,19H,5-7H2,1-4H3,(H,20,21) |
| InChIKey | SJRMOCUIFDZCER-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|