C16H21F2N3O2 — CID 107166170
tert-butyl N-[3-[(4-cyano-2,6-difluorophenyl)methylamino]propyl]carbamate (PubChem CID 107166170) has the molecular formula C16H21F2N3O2 and a molecular weight of 325.36 g/mol. Its IUPAC name is tert-butyl N-[3-[(4-cyano-2,6-difluorophenyl)methylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(4-cyano-2,6-difluorophenyl)methylamino]propyl]carbamate |
|---|---|
| PubChem CID | 107166170 |
| Molecular Formula | C16H21F2N3O2 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | tert-butyl N-[3-[(4-cyano-2,6-difluorophenyl)methylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNCc1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C16H21F2N3O2/c1-16(2,3)23-15(22)21-6-4-5-20-10-12-13(17)7-11(9-19)8-14(12)18/h7-8,20H,4-6,10H2,1-3H3,(H,21,22) |
| InChIKey | OYBAHHCCLFCPBA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|