C15H20F2N2 — CID 107038759
3,5-difluoro-4-[(5-methylhexylamino)methyl]benzonitrile (PubChem CID 107038759) has the molecular formula C15H20F2N2 and a molecular weight of 266.33 g/mol. Its IUPAC name is 3,5-difluoro-4-[(5-methylhexylamino)methyl]benzonitrile.
| Compound Name | 3,5-difluoro-4-[(5-methylhexylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 107038759 |
| Molecular Formula | C15H20F2N2 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 3,5-difluoro-4-[(5-methylhexylamino)methyl]benzonitrile |
| SMILES | CC(C)CCCCNCc1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C15H20F2N2/c1-11(2)5-3-4-6-19-10-13-14(16)7-12(9-18)8-15(13)17/h7-8,11,19H,3-6,10H2,1-2H3 |
| InChIKey | QZYFGGPHWQNWFX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|