C12H14F2N2O — CID 107037851
4-[(2-ethoxyethylamino)methyl]-3,5-difluorobenzonitrile (PubChem CID 107037851) has the molecular formula C12H14F2N2O and a molecular weight of 240.25 g/mol. Its IUPAC name is 4-[(2-ethoxyethylamino)methyl]-3,5-difluorobenzonitrile.
| Compound Name | 4-[(2-ethoxyethylamino)methyl]-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 107037851 |
| Molecular Formula | C12H14F2N2O |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 4-[(2-ethoxyethylamino)methyl]-3,5-difluorobenzonitrile |
| SMILES | CCOCCNCc1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C12H14F2N2O/c1-2-17-4-3-16-8-10-11(13)5-9(7-15)6-12(10)14/h5-6,16H,2-4,8H2,1H3 |
| InChIKey | KXWOQXKFKUYWQB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|