C12H11F5N2O — CID 107038407
3,5-difluoro-4-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]benzonitrile (PubChem CID 107038407) has the molecular formula C12H11F5N2O and a molecular weight of 294.22 g/mol. Its IUPAC name is 3,5-difluoro-4-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]benzonitrile.
| Compound Name | 3,5-difluoro-4-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 107038407 |
| Molecular Formula | C12H11F5N2O |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 3,5-difluoro-4-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]benzonitrile |
| SMILES | N#Cc1cc(F)c(CNCCOCC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C12H11F5N2O/c13-10-3-8(5-18)4-11(14)9(10)6-19-1-2-20-7-12(15,16)17/h3-4,19H,1-2,6-7H2 |
| InChIKey | UTGPCISNMYWXQJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|