C13H16F2N4O — CID 107038837
3-[2-[(4-cyano-2,6-difluorophenyl)methylamino]ethyl]-1,1-dimethylurea (PubChem CID 107038837) has the molecular formula C13H16F2N4O and a molecular weight of 282.29 g/mol. Its IUPAC name is 3-[2-[(4-cyano-2,6-difluorophenyl)methylamino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(4-cyano-2,6-difluorophenyl)methylamino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 107038837 |
| Molecular Formula | C13H16F2N4O |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 3-[2-[(4-cyano-2,6-difluorophenyl)methylamino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNCc1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C13H16F2N4O/c1-19(2)13(20)18-4-3-17-8-10-11(14)5-9(7-16)6-12(10)15/h5-6,17H,3-4,8H2,1-2H3,(H,18,20) |
| InChIKey | BGILLMSJGGUGBS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|