C12H15F2N3O2S — CID 107165844
N-[3-[(4-cyano-2,6-difluorophenyl)methylamino]propyl]methanesulfonamide (PubChem CID 107165844) has the molecular formula C12H15F2N3O2S and a molecular weight of 303.33 g/mol. Its IUPAC name is N-[3-[(4-cyano-2,6-difluorophenyl)methylamino]propyl]methanesulfonamide.
| Compound Name | N-[3-[(4-cyano-2,6-difluorophenyl)methylamino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 107165844 |
| Molecular Formula | C12H15F2N3O2S |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | N-[3-[(4-cyano-2,6-difluorophenyl)methylamino]propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCNCc1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C12H15F2N3O2S/c1-20(18,19)17-4-2-3-16-8-10-11(13)5-9(7-15)6-12(10)14/h5-6,16-17H,2-4,8H2,1H3 |
| InChIKey | JWDYONMTADXCNE-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|