C15H21F2N3 — CID 107166144
4-[[2-[butan-2-yl(methyl)amino]ethylamino]methyl]-3,5-difluorobenzonitrile (PubChem CID 107166144) has the molecular formula C15H21F2N3 and a molecular weight of 281.35 g/mol. Its IUPAC name is 4-[[2-[butan-2-yl(methyl)amino]ethylamino]methyl]-3,5-difluorobenzonitrile.
| Compound Name | 4-[[2-[butan-2-yl(methyl)amino]ethylamino]methyl]-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 107166144 |
| Molecular Formula | C15H21F2N3 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 4-[[2-[butan-2-yl(methyl)amino]ethylamino]methyl]-3,5-difluorobenzonitrile |
| SMILES | CCC(C)N(C)CCNCc1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C15H21F2N3/c1-4-11(2)20(3)6-5-19-10-13-14(16)7-12(9-18)8-15(13)17/h7-8,11,19H,4-6,10H2,1-3H3 |
| InChIKey | DSNRUMDEBYEOKK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|