C12H12F4N2O — CID 107166910
4-[[2-(2,2-difluoroethoxy)ethylamino]methyl]-3,5-difluorobenzonitrile (PubChem CID 107166910) has the molecular formula C12H12F4N2O and a molecular weight of 276.23 g/mol. Its IUPAC name is 4-[[2-(2,2-difluoroethoxy)ethylamino]methyl]-3,5-difluorobenzonitrile.
| Compound Name | 4-[[2-(2,2-difluoroethoxy)ethylamino]methyl]-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 107166910 |
| Molecular Formula | C12H12F4N2O |
| Molecular Weight | 276.23 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 4-[[2-(2,2-difluoroethoxy)ethylamino]methyl]-3,5-difluorobenzonitrile |
| SMILES | N#Cc1cc(F)c(CNCCOCC(F)F)c(F)c1 |
| InChI | InChI=1S/C12H12F4N2O/c13-10-3-8(5-17)4-11(14)9(10)6-18-1-2-19-7-12(15)16/h3-4,12,18H,1-2,6-7H2 |
| InChIKey | UWIGOEGXVSVUDE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|