C10H12F2N2OS — CID 103081001
5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]thiophene-3-carbonitrile (PubChem CID 103081001) has the molecular formula C10H12F2N2OS and a molecular weight of 246.28 g/mol. Its IUPAC name is 5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]thiophene-3-carbonitrile.
| Compound Name | 5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 103081001 |
| Molecular Formula | C10H12F2N2OS |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]thiophene-3-carbonitrile |
| SMILES | N#Cc1csc(CNCCOCC(F)F)c1 |
| InChI | InChI=1S/C10H12F2N2OS/c11-10(12)6-15-2-1-14-5-9-3-8(4-13)7-16-9/h3,7,10,14H,1-2,5-6H2 |
| InChIKey | CIGNIVSYHKVUTH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|