C10H11F3N2OS — CID 79545191
5-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]thiophene-3-carbonitrile (PubChem CID 79545191) has the molecular formula C10H11F3N2OS and a molecular weight of 264.27 g/mol. Its IUPAC name is 5-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]thiophene-3-carbonitrile.
| Compound Name | 5-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 79545191 |
| Molecular Formula | C10H11F3N2OS |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 5-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]thiophene-3-carbonitrile |
| SMILES | N#Cc1csc(CNCCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C10H11F3N2OS/c11-10(12,13)7-16-2-1-15-5-9-3-8(4-14)6-17-9/h3,6,15H,1-2,5,7H2 |
| InChIKey | OQIDJZUKMZCIRD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|