C10H13BrF3NOS — CID 82958028
N-[(4-bromothiophen-2-yl)methyl]-2-(3,3,3-trifluoropropoxy)ethanamine (PubChem CID 82958028) has the molecular formula C10H13BrF3NOS and a molecular weight of 332.19 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-(3,3,3-trifluoropropoxy)ethanamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-(3,3,3-trifluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 82958028 |
| Molecular Formula | C10H13BrF3NOS |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-(3,3,3-trifluoropropoxy)ethanamine |
| SMILES | FC(F)(F)CCOCCNCc1cc(Br)cs1 |
| InChI | InChI=1S/C10H13BrF3NOS/c11-8-5-9(17-7-8)6-15-2-4-16-3-1-10(12,13)14/h5,7,15H,1-4,6H2 |
| InChIKey | GPVLGFIOXDZCNO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|