C15H27BrN2O2S — CID 82944029
N-[(4-bromothiophen-2-yl)methyl]-N',N'-bis(2-ethoxyethyl)ethane-1,2-diamine (PubChem CID 82944029) has the molecular formula C15H27BrN2O2S and a molecular weight of 379.36 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-N',N'-bis(2-ethoxyethyl)ethane-1,2-diamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-N',N'-bis(2-ethoxyethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 82944029 |
| Molecular Formula | C15H27BrN2O2S |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-N',N'-bis(2-ethoxyethyl)ethane-1,2-diamine |
| SMILES | CCOCCN(CCNCc1cc(Br)cs1)CCOCC |
| InChI | InChI=1S/C15H27BrN2O2S/c1-3-19-9-7-18(8-10-20-4-2)6-5-17-12-15-11-14(16)13-21-15/h11,13,17H,3-10,12H2,1-2H3 |
| InChIKey | PSRWVTORVJRKCH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|