C16H30N2O2S — CID 82943589
N',N'-bis(2-ethoxyethyl)-N-(2-thiophen-2-ylethyl)ethane-1,2-diamine (PubChem CID 82943589) has the molecular formula C16H30N2O2S and a molecular weight of 314.49 g/mol. Its IUPAC name is N',N'-bis(2-ethoxyethyl)-N-(2-thiophen-2-ylethyl)ethane-1,2-diamine.
| Compound Name | N',N'-bis(2-ethoxyethyl)-N-(2-thiophen-2-ylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 82943589 |
| Molecular Formula | C16H30N2O2S |
| Molecular Weight | 314.49 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | N',N'-bis(2-ethoxyethyl)-N-(2-thiophen-2-ylethyl)ethane-1,2-diamine |
| SMILES | CCOCCN(CCNCCc1cccs1)CCOCC |
| InChI | InChI=1S/C16H30N2O2S/c1-3-19-13-11-18(12-14-20-4-2)10-9-17-8-7-16-6-5-15-21-16/h5-6,15,17H,3-4,7-14H2,1-2H3 |
| InChIKey | GECTUMFVDSSGEY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|