C15H28N2OS — CID 55088870
N-(4-ethoxybutyl)-N'-ethyl-N'-(thiophen-2-ylmethyl)ethane-1,2-diamine (PubChem CID 55088870) has the molecular formula C15H28N2OS and a molecular weight of 284.47 g/mol. Its IUPAC name is N-(4-ethoxybutyl)-N'-ethyl-N'-(thiophen-2-ylmethyl)ethane-1,2-diamine.
| Compound Name | N-(4-ethoxybutyl)-N'-ethyl-N'-(thiophen-2-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 55088870 |
| Molecular Formula | C15H28N2OS |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | N-(4-ethoxybutyl)-N'-ethyl-N'-(thiophen-2-ylmethyl)ethane-1,2-diamine |
| SMILES | CCOCCCCNCCN(CC)Cc1cccs1 |
| InChI | InChI=1S/C15H28N2OS/c1-3-17(14-15-8-7-13-19-15)11-10-16-9-5-6-12-18-4-2/h7-8,13,16H,3-6,9-12,14H2,1-2H3 |
| InChIKey | GOUNOGFQRYXNTL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|