C14H26N2OS — CID 62555499
N'-ethyl-N'-(1-methoxypropan-2-yl)-N-(2-thiophen-2-ylethyl)ethane-1,2-diamine (PubChem CID 62555499) has the molecular formula C14H26N2OS and a molecular weight of 270.44 g/mol. Its IUPAC name is N'-ethyl-N'-(1-methoxypropan-2-yl)-N-(2-thiophen-2-ylethyl)ethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-(1-methoxypropan-2-yl)-N-(2-thiophen-2-ylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62555499 |
| Molecular Formula | C14H26N2OS |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | N'-ethyl-N'-(1-methoxypropan-2-yl)-N-(2-thiophen-2-ylethyl)ethane-1,2-diamine |
| SMILES | CCN(CCNCCc1cccs1)C(C)COC |
| InChI | InChI=1S/C14H26N2OS/c1-4-16(13(2)12-17-3)10-9-15-8-7-14-6-5-11-18-14/h5-6,11,13,15H,4,7-10,12H2,1-3H3 |
| InChIKey | HGIPPNBDYXLOQV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|