C10H17NOS — CID 94472999
(2S)-1-methoxy-N-(2-thiophen-2-ylethyl)propan-2-amine (PubChem CID 94472999) has the molecular formula C10H17NOS and a molecular weight of 199.32 g/mol. Its IUPAC name is (2S)-1-methoxy-N-(2-thiophen-2-ylethyl)propan-2-amine.
| Compound Name | (2S)-1-methoxy-N-(2-thiophen-2-ylethyl)propan-2-amine |
|---|---|
| PubChem CID | 94472999 |
| Molecular Formula | C10H17NOS |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | (2S)-1-methoxy-N-(2-thiophen-2-ylethyl)propan-2-amine |
| SMILES | COC[C@H](C)NCCc1cccs1 |
| InChI | InChI=1S/C10H17NOS/c1-9(8-12-2)11-6-5-10-4-3-7-13-10/h3-4,7,9,11H,5-6,8H2,1-2H3/t9-/m0/s1 |
| InChIKey | DEMOLOOPUMQZDS-VIFPVBQESA-N |
| XLogP | 1.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |